About 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one
4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one (PubChem CID 168942784) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one.
Molecular Properties
| Compound Name | 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one |
| PubChem CID | 168942784 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one |
| SMILES | CCn1c2ccccc2c2[nH][nH]c(=O)c21 |
| InChI | InChI=1S/C11H11N3O/c1-2-14-8-6-4-3-5-7(8)9-10(14)11(15)13-12-9/h3-6H,2H2,1H3,(H2,12,13,15) |
| InChIKey | MGMGFYKQYUWRTA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one?
The IUPAC name of 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one (CID 168942784) is 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one.
What is the SMILES notation for 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one?
The canonical SMILES for 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one is CCn1c2ccccc2c2[nH][nH]c(=O)c21.
What is the InChIKey of 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one?
The InChIKey is MGMGFYKQYUWRTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c1-2-14-8-6-4-3-5-7(8)9-10(14)11(15)13-12-9/h3-6H,2H2,1H3,(H2,12,13,15).
What are the key properties of 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one?
4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one has a molecular weight of 201.23 g/mol, XLogP of 1.83, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1,2-dihydropyrazolo[4,3-b]indol-3-one is sourced from PubChem (CID 168942784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).