C17H21NO6 — CID 168943171
2-methoxy-5-[5-[1-(2-methoxyethoxy)cyclopropyl]-4,5-dihydro-1,2-oxazol-3-yl]benzoic acid (PubChem CID 168943171) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-methoxy-5-[5-[1-(2-methoxyethoxy)cyclopropyl]-4,5-dihydro-1,2-oxazol-3-yl]benzoic acid.
| Compound Name | 2-methoxy-5-[5-[1-(2-methoxyethoxy)cyclopropyl]-4,5-dihydro-1,2-oxazol-3-yl]benzoic acid |
|---|---|
| PubChem CID | 168943171 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-methoxy-5-[5-[1-(2-methoxyethoxy)cyclopropyl]-4,5-dihydro-1,2-oxazol-3-yl]benzoic acid |
| SMILES | COCCOC1(C2CC(c3ccc(OC)c(C(=O)O)c3)=NO2)CC1 |
| InChI | InChI=1S/C17H21NO6/c1-21-7-8-23-17(5-6-17)15-10-13(18-24-15)11-3-4-14(22-2)12(9-11)16(19)20/h3-4,9,15H,5-8,10H2,1-2H3,(H,19,20) |
| InChIKey | ZFYJHLGEHCWLSB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 86.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|