C60H102F15N3O5 — CID 168943861
bis(2-hexyldecyl) 7-[2-(4-methylpiperazin-1-yl)ethyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate (PubChem CID 168943861) has the molecular formula C60H102F15N3O5 and a molecular weight of 1230.46 g/mol. Its IUPAC name is bis(2-hexyldecyl) 7-[2-(4-methylpiperazin-1-yl)ethyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate.
| Compound Name | bis(2-hexyldecyl) 7-[2-(4-methylpiperazin-1-yl)ethyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
|---|---|
| PubChem CID | 168943861 |
| Molecular Formula | C60H102F15N3O5 |
| Molecular Weight | 1230.46 g/mol |
| Exact Mass | 1229.76 |
| IUPAC Name | bis(2-hexyldecyl) 7-[2-(4-methylpiperazin-1-yl)ethyl-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)amino]tridecanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(CCCCCC(=O)OCC(CCCCCC)CCCCCCCC)N(CCN1CCN(C)CC1)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C60H102F15N3O5/c1-6-10-14-18-20-26-34-48(32-24-16-12-8-3)46-82-51(79)38-30-22-28-36-50(37-29-23-31-39-52(80)83-47-49(33-25-17-13-9-4)35-27-21-19-15-11-7-2)78(45-44-77-42-40-76(5)41-43-77)53(81)54(61,62)55(63,64)56(65,66)57(67,68)58(69,70)59(71,72)60(73,74)75/h48-50H,6-47H2,1-5H3 |
| InChIKey | STZRBJPGMPOTDI-UHFFFAOYSA-N |
| XLogP | 18.47 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1230.46 |
| LogP ≤ 5 | 18.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|