About bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate
bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate (PubChem CID 168943897) has the molecular formula C60H115FN2O5
and a molecular weight of 963.59 g/mol. Its IUPAC name is bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate.
Molecular Properties
| Compound Name | bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate |
| PubChem CID | 168943897 |
| Molecular Formula | C60H115FN2O5 |
| Molecular Weight | 963.59 g/mol |
| Exact Mass | 962.88 |
| IUPAC Name | bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate |
| SMILES | CCCCCCCC(F)C(=O)N(CCCCN1CCCC1)C(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCCCCC(=O)OCC(CCCC)CCCCCC |
| InChI | InChI=1S/C60H115FN2O5/c1-6-11-16-23-32-45-57(61)60(66)63(51-38-37-50-62-48-35-36-49-62)56(43-30-24-19-21-26-33-46-58(64)67-52-54(39-14-9-4)41-28-17-12-7-2)44-31-25-20-22-27-34-47-59(65)68-53-55(40-15-10-5)42-29-18-13-8-3/h54-57H,6-53H2,1-5H3 |
| InChIKey | ONPZGUFFWHPMMI-UHFFFAOYSA-N |
| XLogP | 17.64 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 68 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 963.59 |
| LogP ≤ 5 | 17.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate?
The IUPAC name of bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate (CID 168943897) is bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate.
What is the SMILES notation for bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate?
The canonical SMILES for bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate is CCCCCCCC(F)C(=O)N(CCCCN1CCCC1)C(CCCCCCCCC(=O)OCC(CCCC)CCCCCC)CCCCCCCCC(=O)OCC(CCCC)CCCCCC.
What is the InChIKey of bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate?
The InChIKey is ONPZGUFFWHPMMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C60H115FN2O5/c1-6-11-16-23-32-45-57(61)60(66)63(51-38-37-50-62-48-35-36-49-62)56(43-30-24-19-21-26-33-46-58(64)67-52-54(39-14-9-4)41-28-17-12-7-2)44-31-25-20-22-27-34-47-59(65)68-53-55(40-15-10-5)42-29-18-13-8-3/h54-57H,6-53H2,1-5H3.
What are the key properties of bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate?
bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate has a molecular weight of 963.59 g/mol, XLogP of 17.64, 51 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butyloctyl) 10-[2-fluorononanoyl(4-pyrrolidin-1-ylbutyl)amino]nonadecanedioate is sourced from PubChem (CID 168943897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).