About N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide
N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide (PubChem CID 168944588) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide.
Molecular Properties
| Compound Name | N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide |
| PubChem CID | 168944588 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide |
| SMILES | Cc1cc(CCCO)cc(C)c1NC=O |
| InChI | InChI=1S/C12H17NO2/c1-9-6-11(4-3-5-14)7-10(2)12(9)13-8-15/h6-8,14H,3-5H2,1-2H3,(H,13,15) |
| InChIKey | NIEOSQYOOROWLV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide?
The IUPAC name of N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide (CID 168944588) is N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide.
What is the SMILES notation for N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide?
The canonical SMILES for N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide is Cc1cc(CCCO)cc(C)c1NC=O.
What is the InChIKey of N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide?
The InChIKey is NIEOSQYOOROWLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-9-6-11(4-3-5-14)7-10(2)12(9)13-8-15/h6-8,14H,3-5H2,1-2H3,(H,13,15).
What are the key properties of N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide?
N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide has a molecular weight of 207.27 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3-hydroxypropyl)-2,6-dimethylphenyl]formamide is sourced from PubChem (CID 168944588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).