C22H20F3N5OS — CID 168945147
3-[4-(difluoromethylsulfanylamino)-3-[(4-fluorophenyl)methoxy]phenyl]-1,7-dimethylpyrazolo[4,5-c]pyridin-4-amine (PubChem CID 168945147) has the molecular formula C22H20F3N5OS and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[4-(difluoromethylsulfanylamino)-3-[(4-fluorophenyl)methoxy]phenyl]-1,7-dimethylpyrazolo[4,5-c]pyridin-4-amine.
| Compound Name | 3-[4-(difluoromethylsulfanylamino)-3-[(4-fluorophenyl)methoxy]phenyl]-1,7-dimethylpyrazolo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 168945147 |
| Molecular Formula | C22H20F3N5OS |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[4-(difluoromethylsulfanylamino)-3-[(4-fluorophenyl)methoxy]phenyl]-1,7-dimethylpyrazolo[4,5-c]pyridin-4-amine |
| SMILES | Cc1cnc(N)c2c(-c3ccc(NSC(F)F)c(OCc4ccc(F)cc4)c3)nn(C)c12 |
| InChI | InChI=1S/C22H20F3N5OS/c1-12-10-27-21(26)18-19(28-30(2)20(12)18)14-5-8-16(29-32-22(24)25)17(9-14)31-11-13-3-6-15(23)7-4-13/h3-10,22,29H,11H2,1-2H3,(H2,26,27) |
| InChIKey | QXXQXCBPZWUDGG-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|