C21H15ClF3N3O3S — CID 168945170
N-[4-(2-chloro-3-cyano-4-pyridinyl)-2-[(1S)-1-(4-fluorophenyl)ethoxy]phenyl]-1,1-difluoromethanesulfonamide (PubChem CID 168945170) has the molecular formula C21H15ClF3N3O3S and a molecular weight of 481.88 g/mol. Its IUPAC name is N-[4-(2-chloro-3-cyano-4-pyridinyl)-2-[(1S)-1-(4-fluorophenyl)ethoxy]phenyl]-1,1-difluoromethanesulfonamide.
| Compound Name | N-[4-(2-chloro-3-cyano-4-pyridinyl)-2-[(1S)-1-(4-fluorophenyl)ethoxy]phenyl]-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 168945170 |
| Molecular Formula | C21H15ClF3N3O3S |
| Molecular Weight | 481.88 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | N-[4-(2-chloro-3-cyano-4-pyridinyl)-2-[(1S)-1-(4-fluorophenyl)ethoxy]phenyl]-1,1-difluoromethanesulfonamide |
| SMILES | C[C@H](Oc1cc(-c2ccnc(Cl)c2C#N)ccc1NS(=O)(=O)C(F)F)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H15ClF3N3O3S/c1-12(13-2-5-15(23)6-3-13)31-19-10-14(16-8-9-27-20(22)17(16)11-26)4-7-18(19)28-32(29,30)21(24)25/h2-10,12,21,28H,1H3/t12-/m0/s1 |
| InChIKey | NNIBYZRYSNFQBW-LBPRGKRZSA-N |
| XLogP | 5.52 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.88 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|