About 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine
4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine (PubChem CID 168945310) has the molecular formula C11H20BrN3
and a molecular weight of 274.21 g/mol. Its IUPAC name is 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine.
Molecular Properties
| Compound Name | 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine |
| PubChem CID | 168945310 |
| Molecular Formula | C11H20BrN3 |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine |
| SMILES | Brc1cn[nH]c1.CN1CCCCC1(C)C |
| InChI | InChI=1S/C8H17N.C3H3BrN2/c1-8(2)6-4-5-7-9(8)3;4-3-1-5-6-2-3/h4-7H2,1-3H3;1-2H,(H,5,6) |
| InChIKey | PVKPIBMOVAIALM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine?
The IUPAC name of 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine (CID 168945310) is 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine.
What is the SMILES notation for 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine?
The canonical SMILES for 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine is Brc1cn[nH]c1.CN1CCCCC1(C)C.
What is the InChIKey of 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine?
The InChIKey is PVKPIBMOVAIALM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.C3H3BrN2/c1-8(2)6-4-5-7-9(8)3;4-3-1-5-6-2-3/h4-7H2,1-3H3;1-2H,(H,5,6).
What are the key properties of 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine?
4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine has a molecular weight of 274.21 g/mol, XLogP of 3.05, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-1H-pyrazole;1,2,2-trimethylpiperidine is sourced from PubChem (CID 168945310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).