C16H26N2O3 — CID 168945503
butane;1-[(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 168945503) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is butane;1-[(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | butane;1-[(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 168945503 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | butane;1-[(2Z,4Z)-2-methoxyhepta-2,4,6-trien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C=C\C(=C(/C)OC)N1CCC(=O)NC1=O.CCCC |
| InChI | InChI=1S/C12H16N2O3.C4H10/c1-4-5-6-10(9(2)17-3)14-8-7-11(15)13-12(14)16;1-3-4-2/h4-6H,1,7-8H2,2-3H3,(H,13,15,16);3-4H2,1-2H3/b6-5-,10-9-; |
| InChIKey | GDHUTFWFCXAUSJ-VBRHXNBESA-N |
| XLogP | 3.35 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|