C22H20FN7O4 — CID 168945561
5-[2-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carbaldehyde;methanamine (PubChem CID 168945561) has the molecular formula C22H20FN7O4 and a molecular weight of 465.45 g/mol. Its IUPAC name is 5-[2-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carbaldehyde;methanamine.
| Compound Name | 5-[2-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carbaldehyde;methanamine |
|---|---|
| PubChem CID | 168945561 |
| Molecular Formula | C22H20FN7O4 |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | 5-[2-[(4-fluorophenyl)methoxy]-4-nitrophenyl]-3-(pyrazin-2-ylamino)-1H-pyrazole-4-carbaldehyde;methanamine |
| SMILES | CN.O=Cc1c(Nc2cnccn2)n[nH]c1-c1ccc([N+](=O)[O-])cc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C21H15FN6O4.CH5N/c22-14-3-1-13(2-4-14)12-32-18-9-15(28(30)31)5-6-16(18)20-17(11-29)21(27-26-20)25-19-10-23-7-8-24-19;1-2/h1-11H,12H2,(H2,24,25,26,27);2H2,1H3 |
| InChIKey | HWBLVLUVKKZORW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 161.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|