C11H14N2O3 — CID 168945666
1-(2-methoxycyclohexa-1,5-dien-1-yl)-1,3-diazinane-2,4-dione (PubChem CID 168945666) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-(2-methoxycyclohexa-1,5-dien-1-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 1-(2-methoxycyclohexa-1,5-dien-1-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 168945666 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-(2-methoxycyclohexa-1,5-dien-1-yl)-1,3-diazinane-2,4-dione |
| SMILES | COC1=C(N2CCC(=O)NC2=O)C=CCC1 |
| InChI | InChI=1S/C11H14N2O3/c1-16-9-5-3-2-4-8(9)13-7-6-10(14)12-11(13)15/h2,4H,3,5-7H2,1H3,(H,12,14,15) |
| InChIKey | ADXWIPAWRUTUGB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |