C31H32CsF3N7O7S — CID 168946577
CID 168946577 (PubChem CID 168946577) has the molecular formula C31H32CsF3N7O7S and a molecular weight of 836.60 g/mol.
| Compound Name | CID 168946577 |
|---|---|
| PubChem CID | 168946577 |
| Molecular Formula | C31H32CsF3N7O7S |
| Molecular Weight | 836.60 g/mol |
| Exact Mass | 836.11 |
| IUPAC Name | — |
| SMILES | CC(Oc1cc(-c2nn(C)c3c(-c4cnn(CCOCCOCC(=O)O)c4)cnc(N)c23)ccc1NS(=O)(=O)C(F)F)c1ccc(F)cc1.[Cs] |
| InChI | InChI=1S/C31H32F3N7O7S.Cs/c1-18(19-3-6-22(32)7-4-19)48-25-13-20(5-8-24(25)39-49(44,45)31(33)34)28-27-29(40(2)38-28)23(15-36-30(27)35)21-14-37-41(16-21)9-10-46-11-12-47-17-26(42)43;/h3-8,13-16,18,31,39H,9-12,17H2,1-2H3,(H2,35,36)(H,42,43); |
| InChIKey | AYUUISIBOPJXKN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 185.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.60 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|