C28H32F2N4O3 — CID 168947107
(2R,3S)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-2-methylpyrrolidine-3-carboxylic acid (PubChem CID 168947107) has the molecular formula C28H32F2N4O3 and a molecular weight of 510.59 g/mol. Its IUPAC name is (2R,3S)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-2-methylpyrrolidine-3-carboxylic acid.
| Compound Name | (2R,3S)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-2-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168947107 |
| Molecular Formula | C28H32F2N4O3 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (2R,3S)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-2-methylpyrrolidine-3-carboxylic acid |
| SMILES | C[C@@H]1[C@@H](C(=O)O)CCN1C(=O)c1c(CCCCCCC#CC2CC(F)(F)C2)n(C)c2ncc(C#N)cc12 |
| InChI | InChI=1S/C28H32F2N4O3/c1-18-21(27(36)37)11-12-34(18)26(35)24-22-13-20(16-31)17-32-25(22)33(2)23(24)10-8-6-4-3-5-7-9-19-14-28(29,30)15-19/h13,17-19,21H,3-6,8,10-12,14-15H2,1-2H3,(H,36,37)/t18-,21+/m1/s1 |
| InChIKey | TZYRUAOHRDILCI-NQIIRXRSSA-N |
| XLogP | 4.92 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|