C30H36F2N4O3S — CID 168947109
(2S)-6-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid;ethane (PubChem CID 168947109) has the molecular formula C30H36F2N4O3S and a molecular weight of 570.71 g/mol. Its IUPAC name is (2S)-6-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid;ethane.
| Compound Name | (2S)-6-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 168947109 |
| Molecular Formula | C30H36F2N4O3S |
| Molecular Weight | 570.71 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | (2S)-6-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid;ethane |
| SMILES | CC.Cn1c(CCCCCCC#CC2CC(F)(F)C2)c(C(=O)N2CCC3(C2)S[C@H]3C(=O)O)c2cc(C#N)cnc21 |
| InChI | InChI=1S/C28H30F2N4O3S.C2H6/c1-33-21(9-7-5-3-2-4-6-8-18-13-28(29,30)14-18)22(20-12-19(15-31)16-32-24(20)33)25(35)34-11-10-27(17-34)23(38-27)26(36)37;1-2/h12,16,18,23H,2-5,7,9-11,13-14,17H2,1H3,(H,36,37);1-2H3/t23-,27?;/m0./s1 |
| InChIKey | OVCRKSZLGWBRPS-XOMKTOPFSA-N |
| XLogP | 5.80 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.71 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|