C27H30F2N4O3 — CID 168947124
(3R)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid (PubChem CID 168947124) has the molecular formula C27H30F2N4O3 and a molecular weight of 496.56 g/mol. Its IUPAC name is (3R)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168947124 |
| Molecular Formula | C27H30F2N4O3 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (3R)-1-[5-cyano-2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cn1c(CCCCCCC#CC2CC(F)(F)C2)c(C(=O)N2CC[C@@H](C(=O)O)C2)c2cc(C#N)cnc21 |
| InChI | InChI=1S/C27H30F2N4O3/c1-32-22(9-7-5-3-2-4-6-8-18-13-27(28,29)14-18)23(21-12-19(15-30)16-31-24(21)32)25(34)33-11-10-20(17-33)26(35)36/h12,16,18,20H,2-5,7,9-11,13-14,17H2,1H3,(H,35,36)/t20-/m1/s1 |
| InChIKey | SNUCZQOWPOWNRO-HXUWFJFHSA-N |
| XLogP | 4.53 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|