C31H42F2N4O3S — CID 168947126
2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-3-formyl-1-methylpyrrolo[2,3-b]pyridine-5-carbonitrile;methyl acetate;4-methyl-1,4-thiazepane (PubChem CID 168947126) has the molecular formula C31H42F2N4O3S and a molecular weight of 588.77 g/mol. Its IUPAC name is 2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-3-formyl-1-methylpyrrolo[2,3-b]pyridine-5-carbonitrile;methyl acetate;4-methyl-1,4-thiazepane.
| Compound Name | 2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-3-formyl-1-methylpyrrolo[2,3-b]pyridine-5-carbonitrile;methyl acetate;4-methyl-1,4-thiazepane |
|---|---|
| PubChem CID | 168947126 |
| Molecular Formula | C31H42F2N4O3S |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | 2-[8-(3,3-difluorocyclobutyl)oct-7-ynyl]-3-formyl-1-methylpyrrolo[2,3-b]pyridine-5-carbonitrile;methyl acetate;4-methyl-1,4-thiazepane |
| SMILES | CN1CCCSCC1.COC(C)=O.Cn1c(CCCCCCC#CC2CC(F)(F)C2)c(C=O)c2cc(C#N)cnc21 |
| InChI | InChI=1S/C22H23F2N3O.C6H13NS.C3H6O2/c1-27-20(19(15-28)18-10-17(13-25)14-26-21(18)27)9-7-5-3-2-4-6-8-16-11-22(23,24)12-16;1-7-3-2-5-8-6-4-7;1-3(4)5-2/h10,14-16H,2-5,7,9,11-12H2,1H3;2-6H2,1H3;1-2H3 |
| InChIKey | PGVCEDCJFZTDET-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 88.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|