C26H30ClF2NO4 — CID 168947149
(3S)-5-[5-chloro-2-[2-[5-(3,3-difluorocyclobutyl)pent-4-ynoxy]ethyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947149) has the molecular formula C26H30ClF2NO4 and a molecular weight of 493.98 g/mol. Its IUPAC name is (3S)-5-[5-chloro-2-[2-[5-(3,3-difluorocyclobutyl)pent-4-ynoxy]ethyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-chloro-2-[2-[5-(3,3-difluorocyclobutyl)pent-4-ynoxy]ethyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947149 |
| Molecular Formula | C26H30ClF2NO4 |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | (3S)-5-[5-chloro-2-[2-[5-(3,3-difluorocyclobutyl)pent-4-ynoxy]ethyl]-1-methylindol-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(CCOCCCC#CC2CC(F)(F)C2)n(C)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C26H30ClF2NO4/c1-17(13-24(32)33)12-23(31)25-20-14-19(27)7-8-21(20)30(2)22(25)9-11-34-10-5-3-4-6-18-15-26(28,29)16-18/h7-8,14,17-18H,3,5,9-13,15-16H2,1-2H3,(H,32,33)/t17-/m0/s1 |
| InChIKey | UJSQMYBUXITQFK-KRWDZBQOSA-N |
| XLogP | 5.90 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|