C28H33F2N3O3 — CID 168947156
(3S)-5-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid (PubChem CID 168947156) has the molecular formula C28H33F2N3O3 and a molecular weight of 497.59 g/mol. Its IUPAC name is (3S)-5-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3S)-5-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 168947156 |
| Molecular Formula | C28H33F2N3O3 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (3S)-5-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridin-3-yl]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@H](CC(=O)O)CC(=O)c1c(CCCCCCCC#CC2CC(F)(F)C2)n(C)c2ncc(C#N)cc12 |
| InChI | InChI=1S/C28H33F2N3O3/c1-19(13-25(35)36)12-24(34)26-22-14-21(17-31)18-32-27(22)33(2)23(26)11-9-7-5-3-4-6-8-10-20-15-28(29,30)16-20/h14,18-20H,3-7,9,11-13,15-16H2,1-2H3,(H,35,36)/t19-/m0/s1 |
| InChIKey | PKSCVKKZUMTXAW-IBGZPJMESA-N |
| XLogP | 6.06 |
| TPSA | 95.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|