C29H32F2N4O3S — CID 168947212
(2S)-6-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid (PubChem CID 168947212) has the molecular formula C29H32F2N4O3S and a molecular weight of 554.66 g/mol. Its IUPAC name is (2S)-6-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid.
| Compound Name | (2S)-6-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 168947212 |
| Molecular Formula | C29H32F2N4O3S |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | (2S)-6-[5-cyano-2-[9-(3,3-difluorocyclobutyl)non-8-ynyl]-1-methylpyrrolo[2,3-b]pyridine-3-carbonyl]-1-thia-6-azaspiro[2.4]heptane-2-carboxylic acid |
| SMILES | Cn1c(CCCCCCCC#CC2CC(F)(F)C2)c(C(=O)N2CCC3(C2)S[C@H]3C(=O)O)c2cc(C#N)cnc21 |
| InChI | InChI=1S/C29H32F2N4O3S/c1-34-22(10-8-6-4-2-3-5-7-9-19-14-29(30,31)15-19)23(21-13-20(16-32)17-33-25(21)34)26(36)35-12-11-28(18-35)24(39-28)27(37)38/h13,17,19,24H,2-6,8,10-12,14-15,18H2,1H3,(H,37,38)/t24-,28?/m0/s1 |
| InChIKey | ZFSCZPYIIIPYTC-ZZDYIDRTSA-N |
| XLogP | 5.16 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|