C21H24FN3OSi — CID 168948088
2-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-4-fluoro-3H-isoindol-1-one (PubChem CID 168948088) has the molecular formula C21H24FN3OSi and a molecular weight of 381.53 g/mol. Its IUPAC name is 2-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-4-fluoro-3H-isoindol-1-one.
| Compound Name | 2-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-4-fluoro-3H-isoindol-1-one |
|---|---|
| PubChem CID | 168948088 |
| Molecular Formula | C21H24FN3OSi |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-4-fluoro-3H-isoindol-1-one |
| SMILES | C[Si](C)(C)C#CCC(c1cnc2n1CCC2)N1Cc2c(F)cccc2C1=O |
| InChI | InChI=1S/C21H24FN3OSi/c1-27(2,3)12-6-9-18(19-13-23-20-10-5-11-24(19)20)25-14-16-15(21(25)26)7-4-8-17(16)22/h4,7-8,13,18H,5,9-11,14H2,1-3H3 |
| InChIKey | VBMWLMVEBJLNPC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|