C17H29N3OSSi — CID 168948268
N-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-2-methylpropane-2-sulfinamide (PubChem CID 168948268) has the molecular formula C17H29N3OSSi and a molecular weight of 351.59 g/mol. Its IUPAC name is N-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 168948268 |
| Molecular Formula | C17H29N3OSSi |
| Molecular Weight | 351.59 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | N-[1-(6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-3-yl)-4-trimethylsilylbut-3-ynyl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC(CC#C[Si](C)(C)C)c1cnc2n1CCC2 |
| InChI | InChI=1S/C17H29N3OSSi/c1-17(2,3)22(21)19-14(9-8-12-23(4,5)6)15-13-18-16-10-7-11-20(15)16/h13-14,19H,7,9-11H2,1-6H3 |
| InChIKey | DINQAVFGCQXLCC-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.59 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|