About acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol
acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol (PubChem CID 168949021) has the molecular formula C8H18N2O3
and a molecular weight of 190.24 g/mol. Its IUPAC name is acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol.
Molecular Properties
| Compound Name | acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol |
| PubChem CID | 168949021 |
| Molecular Formula | C8H18N2O3 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol |
| SMILES | CC(N)=O.OC[C@@H]1C[C@H](O)CCN1 |
| InChI | InChI=1S/C6H13NO2.C2H5NO/c8-4-5-3-6(9)1-2-7-5;1-2(3)4/h5-9H,1-4H2;1H3,(H2,3,4)/t5-,6+;/m0./s1 |
| InChIKey | PSBCOIJIIMPASQ-RIHPBJNCSA-N |
| XLogP | -1.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol?
The IUPAC name of acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol (CID 168949021) is acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol.
What is the SMILES notation for acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol?
The canonical SMILES for acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol is CC(N)=O.OC[C@@H]1C[C@H](O)CCN1.
What is the InChIKey of acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol?
The InChIKey is PSBCOIJIIMPASQ-RIHPBJNCSA-N. The full InChI is InChI=1S/C6H13NO2.C2H5NO/c8-4-5-3-6(9)1-2-7-5;1-2(3)4/h5-9H,1-4H2;1H3,(H2,3,4)/t5-,6+;/m0./s1.
What are the key properties of acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol?
acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol has a molecular weight of 190.24 g/mol, XLogP of -1.42, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;(2S,4R)-2-(hydroxymethyl)piperidin-4-ol is sourced from PubChem (CID 168949021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).