C27H22F2N4O5 — CID 168949027
N-[2-[4,4-difluoro-2-[(4-methyl-2-oxochromen-7-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide (PubChem CID 168949027) has the molecular formula C27H22F2N4O5 and a molecular weight of 520.49 g/mol. Its IUPAC name is N-[2-[4,4-difluoro-2-[(4-methyl-2-oxochromen-7-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide.
| Compound Name | N-[2-[4,4-difluoro-2-[(4-methyl-2-oxochromen-7-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
|---|---|
| PubChem CID | 168949027 |
| Molecular Formula | C27H22F2N4O5 |
| Molecular Weight | 520.49 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-[2-[4,4-difluoro-2-[(4-methyl-2-oxochromen-7-yl)carbamoyl]pyrrolidin-1-yl]-2-oxoethyl]quinoline-4-carboxamide |
| SMILES | Cc1cc(=O)oc2cc(NC(=O)C3CC(F)(F)CN3C(=O)CNC(=O)c3ccnc4ccccc34)ccc12 |
| InChI | InChI=1S/C27H22F2N4O5/c1-15-10-24(35)38-22-11-16(6-7-17(15)22)32-26(37)21-12-27(28,29)14-33(21)23(34)13-31-25(36)19-8-9-30-20-5-3-2-4-18(19)20/h2-11,21H,12-14H2,1H3,(H,31,36)(H,32,37) |
| InChIKey | BUKRCUXUQSUZJL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 121.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|