C12H14BrNO3 — CID 168949302
(2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoic acid (PubChem CID 168949302) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoic acid.
| Compound Name | (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoic acid |
|---|---|
| PubChem CID | 168949302 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoic acid |
| SMILES | [H]/N=C(C)/C(C(=O)O)=C(O)/C(C)=C/C=C(/Br)C=C |
| InChI | InChI=1S/C12H14BrNO3/c1-4-9(13)6-5-7(2)11(15)10(8(3)14)12(16)17/h4-6,14-15H,1H2,2-3H3,(H,16,17)/b7-5+,9-6+,11-10+,14-8+ |
| InChIKey | JNVDBJVXGKTSOH-NKSIDIDLSA-N |
| XLogP | 3.33 |
| TPSA | 81.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|