C13H16BrNO3 — CID 168949408
methyl (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoate (PubChem CID 168949408) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is methyl (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoate.
| Compound Name | methyl (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 168949408 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | methyl (2E,4E,6E)-7-bromo-2-ethanimidoyl-3-hydroxy-4-methylnona-2,4,6,8-tetraenoate |
| SMILES | [H]/N=C(C)/C(C(=O)OC)=C(O)/C(C)=C/C=C(/Br)C=C |
| InChI | InChI=1S/C13H16BrNO3/c1-5-10(14)7-6-8(2)12(16)11(9(3)15)13(17)18-4/h5-7,15-16H,1H2,2-4H3/b8-6+,10-7+,12-11+,15-9+ |
| InChIKey | LNHLBRKTGYGSAT-MMKBAOGLSA-N |
| XLogP | 3.42 |
| TPSA | 70.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|