C24H31N5O2 — CID 168949425
(2Z,5E,7E)-2-amino-8-methoxy-5,9-dimethyl-3-[[[4-[3-[(Z)-prop-1-enyl]iminoprop-1-en-2-yl]pyrimidin-2-yl]amino]methyl]deca-2,5,7,9-tetraen-4-one (PubChem CID 168949425) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (2Z,5E,7E)-2-amino-8-methoxy-5,9-dimethyl-3-[[[4-[3-[(Z)-prop-1-enyl]iminoprop-1-en-2-yl]pyrimidin-2-yl]amino]methyl]deca-2,5,7,9-tetraen-4-one.
| Compound Name | (2Z,5E,7E)-2-amino-8-methoxy-5,9-dimethyl-3-[[[4-[3-[(Z)-prop-1-enyl]iminoprop-1-en-2-yl]pyrimidin-2-yl]amino]methyl]deca-2,5,7,9-tetraen-4-one |
|---|---|
| PubChem CID | 168949425 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | (2Z,5E,7E)-2-amino-8-methoxy-5,9-dimethyl-3-[[[4-[3-[(Z)-prop-1-enyl]iminoprop-1-en-2-yl]pyrimidin-2-yl]amino]methyl]deca-2,5,7,9-tetraen-4-one |
| SMILES | C=C(C)/C(=C\C=C(/C)C(=O)/C(CNc1nccc(C(=C)/C=N/C=C\C)n1)=C(/C)N)OC |
| InChI | InChI=1S/C24H31N5O2/c1-8-12-26-14-18(5)21-11-13-27-24(29-21)28-15-20(19(6)25)23(30)17(4)9-10-22(31-7)16(2)3/h8-14H,2,5,15,25H2,1,3-4,6-7H3,(H,27,28,29)/b12-8-,17-9+,20-19-,22-10+,26-14+ |
| InChIKey | JVVVNNPHUAFBGL-BSUDVBPESA-N |
| XLogP | 4.36 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|