C15H24N2O2 — CID 168949486
(2E,5E,7E,9E)-2,3-diamino-8-methoxy-5,9-dimethyldodeca-2,5,7,9-tetraen-4-one (PubChem CID 168949486) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is (2E,5E,7E,9E)-2,3-diamino-8-methoxy-5,9-dimethyldodeca-2,5,7,9-tetraen-4-one.
| Compound Name | (2E,5E,7E,9E)-2,3-diamino-8-methoxy-5,9-dimethyldodeca-2,5,7,9-tetraen-4-one |
|---|---|
| PubChem CID | 168949486 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | (2E,5E,7E,9E)-2,3-diamino-8-methoxy-5,9-dimethyldodeca-2,5,7,9-tetraen-4-one |
| SMILES | CC/C=C(C)/C(=C\C=C(/C)C(=O)/C(N)=C(/C)N)OC |
| InChI | InChI=1S/C15H24N2O2/c1-6-7-10(2)13(19-5)9-8-11(3)15(18)14(17)12(4)16/h7-9H,6,16-17H2,1-5H3/b10-7+,11-8+,13-9+,14-12+ |
| InChIKey | LNHOCUFCIBJHJH-SQRWMBPASA-N |
| XLogP | 2.54 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|