About 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile
3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile (PubChem CID 168950597) has the molecular formula C14H9F6NO
and a molecular weight of 321.22 g/mol. Its IUPAC name is 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile.
Molecular Properties
| Compound Name | 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile |
| PubChem CID | 168950597 |
| Molecular Formula | C14H9F6NO |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile |
| SMILES | CC(C)c1c(C#N)oc2c(C(F)(F)F)cc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C14H9F6NO/c1-6(2)11-8-3-7(13(15,16)17)4-9(14(18,19)20)12(8)22-10(11)5-21/h3-4,6H,1-2H3 |
| InChIKey | ONPYTBHODWNONW-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 36.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile?
The IUPAC name of 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile (CID 168950597) is 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile.
What is the SMILES notation for 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile?
The canonical SMILES for 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile is CC(C)c1c(C#N)oc2c(C(F)(F)F)cc(C(F)(F)F)cc12.
What is the InChIKey of 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile?
The InChIKey is ONPYTBHODWNONW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9F6NO/c1-6(2)11-8-3-7(13(15,16)17)4-9(14(18,19)20)12(8)22-10(11)5-21/h3-4,6H,1-2H3.
What are the key properties of 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile?
3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile has a molecular weight of 321.22 g/mol, XLogP of 5.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-5,7-bis(trifluoromethyl)-1-benzofuran-2-carbonitrile is sourced from PubChem (CID 168950597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).