About 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid
5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid (PubChem CID 168950691) has the molecular formula C8H5N3O2S
and a molecular weight of 207.21 g/mol. Its IUPAC name is 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid |
| PubChem CID | 168950691 |
| Molecular Formula | C8H5N3O2S |
| Molecular Weight | 207.21 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnsc1-c1ncccn1 |
| InChI | InChI=1S/C8H5N3O2S/c12-8(13)5-4-11-14-6(5)7-9-2-1-3-10-7/h1-4H,(H,12,13) |
| InChIKey | ZXWJWFNFWSDLND-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid?
The IUPAC name of 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid (CID 168950691) is 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid?
The canonical SMILES for 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid is O=C(O)c1cnsc1-c1ncccn1.
What is the InChIKey of 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid?
The InChIKey is ZXWJWFNFWSDLND-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2S/c12-8(13)5-4-11-14-6(5)7-9-2-1-3-10-7/h1-4H,(H,12,13).
What are the key properties of 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid?
5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid has a molecular weight of 207.21 g/mol, XLogP of 1.30, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrimidin-2-yl-1,2-thiazole-4-carboxylic acid is sourced from PubChem (CID 168950691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).