5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid

C11H6N2O2S — CID 168950758

IUPAC5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid
SMILESN#Cc1ccc(-c2scnc2C(=O)O)cc1
InChIInChI=1S/C11H6N2O2S/c12-5-7-1-3-8(4-2-7)10-9(11(14)15)13-6-16-10/h1-4,6H,(H,14,15)
InChIKeyNPYCXLNFEDPATR-UHFFFAOYSA-N
MW230.25 g/mol
LogP2.38
Rot. Bonds2

About 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid

5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 168950758) has the molecular formula C11H6N2O2S and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid.

Molecular Properties

Compound Name5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid
PubChem CID168950758
Molecular FormulaC11H6N2O2S
Molecular Weight230.25 g/mol
Exact Mass230.01
IUPAC Name5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid
SMILESN#Cc1ccc(-c2scnc2C(=O)O)cc1
InChIInChI=1S/C11H6N2O2S/c12-5-7-1-3-8(4-2-7)10-9(11(14)15)13-6-16-10/h1-4,6H,(H,14,15)
InChIKeyNPYCXLNFEDPATR-UHFFFAOYSA-N
XLogP2.38
TPSA73.98 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.25
LogP ≤ 52.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid?
The IUPAC name of 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid (CID 168950758) is 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid is N#Cc1ccc(-c2scnc2C(=O)O)cc1.
What is the InChIKey of 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid?
The InChIKey is NPYCXLNFEDPATR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O2S/c12-5-7-1-3-8(4-2-7)10-9(11(14)15)13-6-16-10/h1-4,6H,(H,14,15).
What are the key properties of 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid?
5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid has a molecular weight of 230.25 g/mol, XLogP of 2.38, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 168950758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).