C11H6N2O2S — CID 168950758
5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid (PubChem CID 168950758) has the molecular formula C11H6N2O2S and a molecular weight of 230.25 g/mol. Its IUPAC name is 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 168950758 |
| Molecular Formula | C11H6N2O2S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.01 |
| IUPAC Name | 5-(4-cyanophenyl)-1,3-thiazole-4-carboxylic acid |
| SMILES | N#Cc1ccc(-c2scnc2C(=O)O)cc1 |
| InChI | InChI=1S/C11H6N2O2S/c12-5-7-1-3-8(4-2-7)10-9(11(14)15)13-6-16-10/h1-4,6H,(H,14,15) |
| InChIKey | NPYCXLNFEDPATR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |