C7H5F3N4S — CID 168951087
7-methyl-2-(trifluoromethyl)-6H-pyrazolo[1,5-a][1,3,5]triazine-4-thione (PubChem CID 168951087) has the molecular formula C7H5F3N4S and a molecular weight of 234.21 g/mol. Its IUPAC name is 7-methyl-2-(trifluoromethyl)-6H-pyrazolo[1,5-a][1,3,5]triazine-4-thione.
| Compound Name | 7-methyl-2-(trifluoromethyl)-6H-pyrazolo[1,5-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 168951087 |
| Molecular Formula | C7H5F3N4S |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.02 |
| IUPAC Name | 7-methyl-2-(trifluoromethyl)-6H-pyrazolo[1,5-a][1,3,5]triazine-4-thione |
| SMILES | Cc1cc2nc(C(F)(F)F)nc(=S)n2[nH]1 |
| InChI | InChI=1S/C7H5F3N4S/c1-3-2-4-11-5(7(8,9)10)12-6(15)14(4)13-3/h2,13H,1H3 |
| InChIKey | RLKUDNIUIDNVFE-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|