About 3,4-dimethyl-2,5-dihydrofuran;ethane
3,4-dimethyl-2,5-dihydrofuran;ethane (PubChem CID 168951375) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 3,4-dimethyl-2,5-dihydrofuran;ethane.
Molecular Properties
| Compound Name | 3,4-dimethyl-2,5-dihydrofuran;ethane |
| PubChem CID | 168951375 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3,4-dimethyl-2,5-dihydrofuran;ethane |
| SMILES | CC.CC.CC1=C(C)COC1 |
| InChI | InChI=1S/C6H10O.2C2H6/c1-5-3-7-4-6(5)2;2*1-2/h3-4H2,1-2H3;2*1-2H3 |
| InChIKey | QTWIXTCINYPJAF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dimethyl-2,5-dihydrofuran;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethyl-2,5-dihydrofuran;ethane?
The IUPAC name of 3,4-dimethyl-2,5-dihydrofuran;ethane (CID 168951375) is 3,4-dimethyl-2,5-dihydrofuran;ethane.
What is the SMILES notation for 3,4-dimethyl-2,5-dihydrofuran;ethane?
The canonical SMILES for 3,4-dimethyl-2,5-dihydrofuran;ethane is CC.CC.CC1=C(C)COC1.
What is the InChIKey of 3,4-dimethyl-2,5-dihydrofuran;ethane?
The InChIKey is QTWIXTCINYPJAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.2C2H6/c1-5-3-7-4-6(5)2;2*1-2/h3-4H2,1-2H3;2*1-2H3.
What are the key properties of 3,4-dimethyl-2,5-dihydrofuran;ethane?
3,4-dimethyl-2,5-dihydrofuran;ethane has a molecular weight of 158.28 g/mol, XLogP of 3.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethyl-2,5-dihydrofuran;ethane is sourced from PubChem (CID 168951375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).