C25H34N4O4Si — CID 168951768
16-methyl-4-(2-trimethylsilylethoxymethyl)-10,18-dioxa-2,4,6,15-tetrazapentacyclo[13.6.2.12,5.019,23.09,24]tetracosa-1(22),5,7,9(24),19(23),20-hexaen-3-one (PubChem CID 168951768) has the molecular formula C25H34N4O4Si and a molecular weight of 482.66 g/mol. Its IUPAC name is 16-methyl-4-(2-trimethylsilylethoxymethyl)-10,18-dioxa-2,4,6,15-tetrazapentacyclo[13.6.2.12,5.019,23.09,24]tetracosa-1(22),5,7,9(24),19(23),20-hexaen-3-one.
| Compound Name | 16-methyl-4-(2-trimethylsilylethoxymethyl)-10,18-dioxa-2,4,6,15-tetrazapentacyclo[13.6.2.12,5.019,23.09,24]tetracosa-1(22),5,7,9(24),19(23),20-hexaen-3-one |
|---|---|
| PubChem CID | 168951768 |
| Molecular Formula | C25H34N4O4Si |
| Molecular Weight | 482.66 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | 16-methyl-4-(2-trimethylsilylethoxymethyl)-10,18-dioxa-2,4,6,15-tetrazapentacyclo[13.6.2.12,5.019,23.09,24]tetracosa-1(22),5,7,9(24),19(23),20-hexaen-3-one |
| SMILES | CC1COc2ccc3cc2N1CCCCOc1ccnc2c1n-3c(=O)n2COCC[Si](C)(C)C |
| InChI | InChI=1S/C25H34N4O4Si/c1-18-16-33-21-8-7-19-15-20(21)27(18)11-5-6-12-32-22-9-10-26-24-23(22)29(19)25(30)28(24)17-31-13-14-34(2,3)4/h7-10,15,18H,5-6,11-14,16-17H2,1-4H3 |
| InChIKey | KANJNGMHECCRMG-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 70.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.66 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|