C25H29N7O2S — CID 168951838
1-benzyl-N-[(3R)-8-[cyclopentyl(methyl)amino]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 168951838) has the molecular formula C25H29N7O2S and a molecular weight of 491.62 g/mol. Its IUPAC name is 1-benzyl-N-[(3R)-8-[cyclopentyl(methyl)amino]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-benzyl-N-[(3R)-8-[cyclopentyl(methyl)amino]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168951838 |
| Molecular Formula | C25H29N7O2S |
| Molecular Weight | 491.62 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | 1-benzyl-N-[(3R)-8-[cyclopentyl(methyl)amino]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3)n2)CSc2cc(N(C)C3CCCC3)ncc21 |
| InChI | InChI=1S/C25H29N7O2S/c1-30(18-10-6-7-11-18)22-12-21-20(13-26-22)31(2)25(34)19(15-35-21)28-24(33)23-27-16-32(29-23)14-17-8-4-3-5-9-17/h3-5,8-9,12-13,16,18-19H,6-7,10-11,14-15H2,1-2H3,(H,28,33)/t19-/m0/s1 |
| InChIKey | RLYXJMBXFYPTOD-IBGZPJMESA-N |
| XLogP | 2.97 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.62 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |