C23H23F2N7O2S — CID 168951847
5-[(2-fluorophenyl)methyl]-N-[(3R)-8-[(3S)-3-fluoropyrrolidin-1-yl]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 168951847) has the molecular formula C23H23F2N7O2S and a molecular weight of 499.55 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-N-[(3R)-8-[(3S)-3-fluoropyrrolidin-1-yl]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl]-N-[(3R)-8-[(3S)-3-fluoropyrrolidin-1-yl]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168951847 |
| Molecular Formula | C23H23F2N7O2S |
| Molecular Weight | 499.55 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-N-[(3R)-8-[(3S)-3-fluoropyrrolidin-1-yl]-5-methyl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2n[nH]c(Cc3ccccc3F)n2)CSc2cc(N3CC[C@H](F)C3)ncc21 |
| InChI | InChI=1S/C23H23F2N7O2S/c1-31-17-10-26-20(32-7-6-14(24)11-32)9-18(17)35-12-16(23(31)34)27-22(33)21-28-19(29-30-21)8-13-4-2-3-5-15(13)25/h2-5,9-10,14,16H,6-8,11-12H2,1H3,(H,27,33)(H,28,29,30)/t14-,16-/m0/s1 |
| InChIKey | VAGXJCAREDEZBS-HOCLYGCPSA-N |
| XLogP | 2.34 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.55 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |