C23H24FN7O2S — CID 168952008
5-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-4-oxo-8-pyrrolidin-1-yl-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide (PubChem CID 168952008) has the molecular formula C23H24FN7O2S and a molecular weight of 481.56 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-4-oxo-8-pyrrolidin-1-yl-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-4-oxo-8-pyrrolidin-1-yl-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168952008 |
| Molecular Formula | C23H24FN7O2S |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 5-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-4-oxo-8-pyrrolidin-1-yl-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2n[nH]c(Cc3ccccc3F)n2)CSc2cc(N3CCCC3)ncc21 |
| InChI | InChI=1S/C23H24FN7O2S/c1-30-17-12-25-20(31-8-4-5-9-31)11-18(17)34-13-16(23(30)33)26-22(32)21-27-19(28-29-21)10-14-6-2-3-7-15(14)24/h2-3,6-7,11-12,16H,4-5,8-10,13H2,1H3,(H,26,32)(H,27,28,29)/t16-/m0/s1 |
| InChIKey | SXEKRTYUHOJSNP-INIZCTEOSA-N |
| XLogP | 2.40 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |