C8H14N2 — CID 168952170
1-(4-ethyl-2,5-dihydro-1H-pyrrol-3-yl)-N-methylmethanimine (PubChem CID 168952170) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1-(4-ethyl-2,5-dihydro-1H-pyrrol-3-yl)-N-methylmethanimine.
| Compound Name | 1-(4-ethyl-2,5-dihydro-1H-pyrrol-3-yl)-N-methylmethanimine |
|---|---|
| PubChem CID | 168952170 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1-(4-ethyl-2,5-dihydro-1H-pyrrol-3-yl)-N-methylmethanimine |
| SMILES | CCC1=C(/C=N/C)CNC1 |
| InChI | InChI=1S/C8H14N2/c1-3-7-5-10-6-8(7)4-9-2/h4,10H,3,5-6H2,1-2H3/b9-4+ |
| InChIKey | KRIBAZAYISSLEA-RUDMXATFSA-N |
| XLogP | 1.00 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|