C23H24FN7O3S — CID 168952240
1-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-8-morpholin-4-yl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide (PubChem CID 168952240) has the molecular formula C23H24FN7O3S and a molecular weight of 497.56 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-8-morpholin-4-yl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-8-morpholin-4-yl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 168952240 |
| Molecular Formula | C23H24FN7O3S |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-[(3R)-5-methyl-8-morpholin-4-yl-4-oxo-2,3-dihydropyrido[4,3-b][1,4]thiazepin-3-yl]-1,2,4-triazole-3-carboxamide |
| SMILES | CN1C(=O)[C@@H](NC(=O)c2ncn(Cc3ccccc3F)n2)CSc2cc(N3CCOCC3)ncc21 |
| InChI | InChI=1S/C23H24FN7O3S/c1-29-18-11-25-20(30-6-8-34-9-7-30)10-19(18)35-13-17(23(29)33)27-22(32)21-26-14-31(28-21)12-15-4-2-3-5-16(15)24/h2-5,10-11,14,17H,6-9,12-13H2,1H3,(H,27,32)/t17-/m0/s1 |
| InChIKey | LFGRCKYKWDJGFJ-KRWDZBQOSA-N |
| XLogP | 1.56 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |