About CID 168952551
CID 168952551 (PubChem CID 168952551) has the molecular formula C26H26F3N4O2SSn+
and a molecular weight of 634.29 g/mol.
Molecular Properties
| Compound Name | CID 168952551 |
| PubChem CID | 168952551 |
| Molecular Formula | C26H26F3N4O2SSn+ |
| Molecular Weight | 634.29 g/mol |
| Exact Mass | 635.07 |
| IUPAC Name | — |
| SMILES | Cc1nc(C(F)(F)F)cc(-c2ccnc3cc(CN4C(=O)C5C(C4O)C5(C)[Sn+])sc23)c1CC1CCNC1 |
| InChI | InChI=1S/C26H26F3N4O2S.Sn/c1-12-21-22(12)25(35)33(24(21)34)11-15-8-19-23(36-15)16(4-6-31-19)18-9-20(26(27,28)29)32-13(2)17(18)7-14-3-5-30-10-14;/h4,6,8-9,14,21-22,24,30,34H,3,5,7,10-11H2,1-2H3;/q;+1 |
| InChIKey | TTYSMRXXJLOAIV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 634.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 168952551 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168952551?
The IUPAC name of CID 168952551 (CID 168952551) is not available.
What is the SMILES notation for CID 168952551?
The canonical SMILES for CID 168952551 is Cc1nc(C(F)(F)F)cc(-c2ccnc3cc(CN4C(=O)C5C(C4O)C5(C)[Sn+])sc23)c1CC1CCNC1.
What is the InChIKey of CID 168952551?
The InChIKey is TTYSMRXXJLOAIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H26F3N4O2S.Sn/c1-12-21-22(12)25(35)33(24(21)34)11-15-8-19-23(36-15)16(4-6-31-19)18-9-20(26(27,28)29)32-13(2)17(18)7-14-3-5-30-10-14;/h4,6,8-9,14,21-22,24,30,34H,3,5,7,10-11H2,1-2H3;/q;+1.
What are the key properties of CID 168952551?
CID 168952551 has a molecular weight of 634.29 g/mol, XLogP of 4.09, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168952551 is sourced from PubChem (CID 168952551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).