C18H23F2N5O2 — CID 168954123
3-[4-[7,7-difluoro-2-(2-methylazetidin-1-yl)-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-oxopropanal (PubChem CID 168954123) has the molecular formula C18H23F2N5O2 and a molecular weight of 379.41 g/mol. Its IUPAC name is 3-[4-[7,7-difluoro-2-(2-methylazetidin-1-yl)-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-oxopropanal.
| Compound Name | 3-[4-[7,7-difluoro-2-(2-methylazetidin-1-yl)-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-oxopropanal |
|---|---|
| PubChem CID | 168954123 |
| Molecular Formula | C18H23F2N5O2 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 3-[4-[7,7-difluoro-2-(2-methylazetidin-1-yl)-5,6-dihydrocyclopenta[d]pyrimidin-4-yl]piperazin-1-yl]-3-oxopropanal |
| SMILES | CC1CCN1c1nc(N2CCN(C(=O)CC=O)CC2)c2c(n1)C(F)(F)CC2 |
| InChI | InChI=1S/C18H23F2N5O2/c1-12-3-6-25(12)17-21-15-13(2-5-18(15,19)20)16(22-17)24-9-7-23(8-10-24)14(27)4-11-26/h11-12H,2-10H2,1H3 |
| InChIKey | NGAJINRATWSMFZ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|