C25H39N — CID 168954382
(2S,10R,14S)-10,14-dimethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene (PubChem CID 168954382) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is (2S,10R,14S)-10,14-dimethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene.
| Compound Name | (2S,10R,14S)-10,14-dimethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene |
|---|---|
| PubChem CID | 168954382 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (2S,10R,14S)-10,14-dimethyl-22-azahexacyclo[12.10.0.02,11.05,10.015,23.017,22]tetracos-4-ene |
| SMILES | C[C@]12CCC3[C@@H](CC=C4CCCC[C@@]43C)C1CC1C2CC2CCCCN21 |
| InChI | InChI=1S/C25H39N/c1-24-12-5-3-7-17(24)9-10-19-20(24)11-13-25(2)21(19)16-23-22(25)15-18-8-4-6-14-26(18)23/h9,18-23H,3-8,10-16H2,1-2H3/t18?,19-,20?,21?,22?,23?,24+,25+/m1/s1 |
| InChIKey | LTAPXAVSIOLCFN-YVJVAJHRSA-N |
| XLogP | 6.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|