C25H33BrFN3O5SSi — CID 168954426
N-[(3R,4S)-3-[5-bromo-3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxyoxan-4-yl]-4-methylbenzenesulfonamide (PubChem CID 168954426) has the molecular formula C25H33BrFN3O5SSi and a molecular weight of 614.61 g/mol. Its IUPAC name is N-[(3R,4S)-3-[5-bromo-3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxyoxan-4-yl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(3R,4S)-3-[5-bromo-3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxyoxan-4-yl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 168954426 |
| Molecular Formula | C25H33BrFN3O5SSi |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 613.11 |
| IUPAC Name | N-[(3R,4S)-3-[5-bromo-3-fluoro-1-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyridin-6-yl]oxyoxan-4-yl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CCOC[C@@H]2Oc2nc3c(cc2Br)c(F)cn3COCC[Si](C)(C)C)cc1 |
| InChI | InChI=1S/C25H33BrFN3O5SSi/c1-17-5-7-18(8-6-17)36(31,32)29-22-9-10-33-15-23(22)35-25-20(26)13-19-21(27)14-30(24(19)28-25)16-34-11-12-37(2,3)4/h5-8,13-14,22-23,29H,9-12,15-16H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | VNJQMHPJBSYAGD-GOTSBHOMSA-N |
| XLogP | 5.07 |
| TPSA | 91.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|