About 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene
4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene (PubChem CID 168955398) has the molecular formula C9H14BrF2O3PS
and a molecular weight of 351.15 g/mol. Its IUPAC name is 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene.
Molecular Properties
| Compound Name | 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene |
| PubChem CID | 168955398 |
| Molecular Formula | C9H14BrF2O3PS |
| Molecular Weight | 351.15 g/mol |
| Exact Mass | 349.96 |
| IUPAC Name | 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene |
| SMILES | CCOP(=O)(OCC)C(F)(F)C1=C(Br)CCS1 |
| InChI | InChI=1S/C9H14BrF2O3PS/c1-3-14-16(13,15-4-2)9(11,12)8-7(10)5-6-17-8/h3-6H2,1-2H3 |
| InChIKey | WGRNADUYPFLFAQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.15 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene?
The IUPAC name of 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene (CID 168955398) is 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene.
What is the SMILES notation for 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene?
The canonical SMILES for 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene is CCOP(=O)(OCC)C(F)(F)C1=C(Br)CCS1.
What is the InChIKey of 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene?
The InChIKey is WGRNADUYPFLFAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrF2O3PS/c1-3-14-16(13,15-4-2)9(11,12)8-7(10)5-6-17-8/h3-6H2,1-2H3.
What are the key properties of 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene?
4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene has a molecular weight of 351.15 g/mol, XLogP of 4.59, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5-[diethoxyphosphoryl(difluoro)methyl]-2,3-dihydrothiophene is sourced from PubChem (CID 168955398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).