About [(Z)-non-2-enyl] 9-bromononanoate
[(Z)-non-2-enyl] 9-bromononanoate (PubChem CID 168955562) has the molecular formula C18H33BrO2
and a molecular weight of 361.36 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 9-bromononanoate.
Molecular Properties
| Compound Name | [(Z)-non-2-enyl] 9-bromononanoate |
| PubChem CID | 168955562 |
| Molecular Formula | C18H33BrO2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | [(Z)-non-2-enyl] 9-bromononanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCCBr |
| InChI | InChI=1S/C18H33BrO2/c1-2-3-4-5-8-11-14-17-21-18(20)15-12-9-6-7-10-13-16-19/h11,14H,2-10,12-13,15-17H2,1H3/b14-11- |
| InChIKey | CNVTXJUHGIYRQP-KAMYIIQDSA-N |
| XLogP | 6.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-non-2-enyl] 9-bromononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-non-2-enyl] 9-bromononanoate?
The IUPAC name of [(Z)-non-2-enyl] 9-bromononanoate (CID 168955562) is [(Z)-non-2-enyl] 9-bromononanoate.
What is the SMILES notation for [(Z)-non-2-enyl] 9-bromononanoate?
The canonical SMILES for [(Z)-non-2-enyl] 9-bromononanoate is CCCCCC/C=C\COC(=O)CCCCCCCCBr.
What is the InChIKey of [(Z)-non-2-enyl] 9-bromononanoate?
The InChIKey is CNVTXJUHGIYRQP-KAMYIIQDSA-N. The full InChI is InChI=1S/C18H33BrO2/c1-2-3-4-5-8-11-14-17-21-18(20)15-12-9-6-7-10-13-16-19/h11,14H,2-10,12-13,15-17H2,1H3/b14-11-.
What are the key properties of [(Z)-non-2-enyl] 9-bromononanoate?
[(Z)-non-2-enyl] 9-bromononanoate has a molecular weight of 361.36 g/mol, XLogP of 6.18, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-non-2-enyl] 9-bromononanoate is sourced from PubChem (CID 168955562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).