C24H27FN4O2S — CID 168956586
N-[1-[6-(6-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfonamide (PubChem CID 168956586) has the molecular formula C24H27FN4O2S and a molecular weight of 454.57 g/mol. Its IUPAC name is N-[1-[6-(6-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfonamide.
| Compound Name | N-[1-[6-(6-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfonamide |
|---|---|
| PubChem CID | 168956586 |
| Molecular Formula | C24H27FN4O2S |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N-[1-[6-(6-cyano-3-pyridinyl)-1-(2,2-dimethylpropyl)-5-fluoroindol-3-yl]ethyl]cyclopropanesulfonamide |
| SMILES | CC(NS(=O)(=O)C1CC1)c1cn(CC(C)(C)C)c2cc(-c3ccc(C#N)nc3)c(F)cc12 |
| InChI | InChI=1S/C24H27FN4O2S/c1-15(28-32(30,31)18-7-8-18)21-13-29(14-24(2,3)4)23-10-19(22(25)9-20(21)23)16-5-6-17(11-26)27-12-16/h5-6,9-10,12-13,15,18,28H,7-8,14H2,1-4H3 |
| InChIKey | TWWGWEHITZQAJI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|