About [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine
[1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine (PubChem CID 168956776) has the molecular formula C21H25FN2
and a molecular weight of 324.44 g/mol. Its IUPAC name is [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine.
Molecular Properties
| Compound Name | [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine |
| PubChem CID | 168956776 |
| Molecular Formula | C21H25FN2 |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine |
| SMILES | Cc1ccccc1-c1cc2c(cc1F)c(CN)cn2CC(C)(C)C |
| InChI | InChI=1S/C21H25FN2/c1-14-7-5-6-8-16(14)18-10-20-17(9-19(18)22)15(11-23)12-24(20)13-21(2,3)4/h5-10,12H,11,13,23H2,1-4H3 |
| InChIKey | QTNCZWLZPZBPGY-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine?
The IUPAC name of [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine (CID 168956776) is [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine.
What is the SMILES notation for [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine?
The canonical SMILES for [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine is Cc1ccccc1-c1cc2c(cc1F)c(CN)cn2CC(C)(C)C.
What is the InChIKey of [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine?
The InChIKey is QTNCZWLZPZBPGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25FN2/c1-14-7-5-6-8-16(14)18-10-20-17(9-19(18)22)15(11-23)12-24(20)13-21(2,3)4/h5-10,12H,11,13,23H2,1-4H3.
What are the key properties of [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine?
[1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine has a molecular weight of 324.44 g/mol, XLogP of 5.26, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylpropyl)-5-fluoro-6-(2-methylphenyl)indol-3-yl]methanamine is sourced from PubChem (CID 168956776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).