C24H25F3N4S — CID 168956888
3-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]-4-(difluoromethyl)pyridine-2-carbonitrile (PubChem CID 168956888) has the molecular formula C24H25F3N4S and a molecular weight of 458.55 g/mol. Its IUPAC name is 3-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]-4-(difluoromethyl)pyridine-2-carbonitrile.
| Compound Name | 3-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]-4-(difluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 168956888 |
| Molecular Formula | C24H25F3N4S |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 3-[3-[(cyclopropylsulfanylamino)methyl]-1-(2,2-dimethylpropyl)-5-fluoroindol-6-yl]-4-(difluoromethyl)pyridine-2-carbonitrile |
| SMILES | CC(C)(C)Cn1cc(CNSC2CC2)c2cc(F)c(-c3c(C(F)F)ccnc3C#N)cc21 |
| InChI | InChI=1S/C24H25F3N4S/c1-24(2,3)13-31-12-14(11-30-32-15-4-5-15)17-8-19(25)18(9-21(17)31)22-16(23(26)27)6-7-29-20(22)10-28/h6-9,12,15,23,30H,4-5,11,13H2,1-3H3 |
| InChIKey | NGLUDYDCBPDRHS-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|