About cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine
cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine (PubChem CID 168956921) has the molecular formula C23H36N2OS
and a molecular weight of 388.62 g/mol. Its IUPAC name is cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine.
Molecular Properties
| Compound Name | cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine |
| PubChem CID | 168956921 |
| Molecular Formula | C23H36N2OS |
| Molecular Weight | 388.62 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine |
| SMILES | CC(N)c1cn(CC(C)(C)C)c2cc(C3CCOCC3)ccc12.SC1CC1 |
| InChI | InChI=1S/C20H30N2O.C3H6S/c1-14(21)18-12-22(13-20(2,3)4)19-11-16(5-6-17(18)19)15-7-9-23-10-8-15;4-3-1-2-3/h5-6,11-12,14-15H,7-10,13,21H2,1-4H3;3-4H,1-2H2 |
| InChIKey | WIAAGSLAHVIODE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine?
The IUPAC name of cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine (CID 168956921) is cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine.
What is the SMILES notation for cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine?
The canonical SMILES for cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine is CC(N)c1cn(CC(C)(C)C)c2cc(C3CCOCC3)ccc12.SC1CC1.
What is the InChIKey of cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine?
The InChIKey is WIAAGSLAHVIODE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H30N2O.C3H6S/c1-14(21)18-12-22(13-20(2,3)4)19-11-16(5-6-17(18)19)15-7-9-23-10-8-15;4-3-1-2-3/h5-6,11-12,14-15H,7-10,13,21H2,1-4H3;3-4H,1-2H2.
What are the key properties of cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine?
cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine has a molecular weight of 388.62 g/mol, XLogP of 5.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanethiol;1-[1-(2,2-dimethylpropyl)-6-(oxan-4-yl)indol-3-yl]ethanamine is sourced from PubChem (CID 168956921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).