C17H25N3O — CID 168957463
N-(4-cyanocyclohexyl)-5,6-dimethylpyridine-2-carboxamide;ethane (PubChem CID 168957463) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(4-cyanocyclohexyl)-5,6-dimethylpyridine-2-carboxamide;ethane.
| Compound Name | N-(4-cyanocyclohexyl)-5,6-dimethylpyridine-2-carboxamide;ethane |
|---|---|
| PubChem CID | 168957463 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | N-(4-cyanocyclohexyl)-5,6-dimethylpyridine-2-carboxamide;ethane |
| SMILES | CC.Cc1ccc(C(=O)NC2CCC(C#N)CC2)nc1C |
| InChI | InChI=1S/C15H19N3O.C2H6/c1-10-3-8-14(17-11(10)2)15(19)18-13-6-4-12(9-16)5-7-13;1-2/h3,8,12-13H,4-7H2,1-2H3,(H,18,19);1-2H3 |
| InChIKey | BOQZSCPBAKVQFA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |