C31H34ClFN6O — CID 168957571
7-(8-chloronaphthalen-1-yl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine (PubChem CID 168957571) has the molecular formula C31H34ClFN6O and a molecular weight of 561.11 g/mol. Its IUPAC name is 7-(8-chloronaphthalen-1-yl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine.
| Compound Name | 7-(8-chloronaphthalen-1-yl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 168957571 |
| Molecular Formula | C31H34ClFN6O |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.25 |
| IUPAC Name | 7-(8-chloronaphthalen-1-yl)-4-[(3R,5S)-3,5-dimethylpiperazin-1-yl]-8-fluoro-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)pyrido[4,3-d]pyrimidine |
| SMILES | C[C@@H]1CN(c2nc(OCC34CCCN3CCC4)nc3c(F)c(-c4cccc5cccc(Cl)c45)ncc23)C[C@H](C)N1 |
| InChI | InChI=1S/C31H34ClFN6O/c1-19-16-38(17-20(2)35-19)29-23-15-34-27(22-9-3-7-21-8-4-10-24(32)25(21)22)26(33)28(23)36-30(37-29)40-18-31-11-5-13-39(31)14-6-12-31/h3-4,7-10,15,19-20,35H,5-6,11-14,16-18H2,1-2H3/t19-,20+ |
| InChIKey | GQPPGLAPPDRUOZ-BGYRXZFFSA-N |
| XLogP | 5.83 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |